C9H9N3O4S3 — CID 100967612
5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 100967612) has the molecular formula C9H9N3O4S3 and a molecular weight of 319.39 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 100967612 |
| Molecular Formula | C9H9N3O4S3 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)c2nnc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C9H9N3O4S3/c1-6-2-4-7(5-3-6)18(13,14)8-11-12-9(17-8)19(10,15)16/h2-5H,1H3,(H2,10,15,16) |
| InChIKey | VYBWZZPODFEEAK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |