C16H15N3O2S2 — CID 110454451
N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-pyridin-3-ylbenzenesulfonamide (PubChem CID 110454451) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-pyridin-3-ylbenzenesulfonamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 110454451 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-4-pyridin-3-ylbenzenesulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(-c3cccnc3)cc2)sc1C |
| InChI | InChI=1S/C16H15N3O2S2/c1-11-12(2)22-16(18-11)19-23(20,21)15-7-5-13(6-8-15)14-4-3-9-17-10-14/h3-10H,1-2H3,(H,18,19) |
| InChIKey | OLEWDBDJZVZMNQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |