C17H17N3O2S2 — CID 110665972
4-ethyl-N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 110665972) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 4-ethyl-N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-ethyl-N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110665972 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-ethyl-N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2nc(C)c(-c3cccnc3)s2)cc1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-3-13-6-8-15(9-7-13)24(21,22)20-17-19-12(2)16(23-17)14-5-4-10-18-11-14/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | IHSQDBDYHUMFCH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |