C9H7N3O5S2 — CID 174961425
5-pyridin-3-yl-2-(sulfoamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 174961425) has the molecular formula C9H7N3O5S2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 5-pyridin-3-yl-2-(sulfoamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-pyridin-3-yl-2-(sulfoamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 174961425 |
| Molecular Formula | C9H7N3O5S2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 5-pyridin-3-yl-2-(sulfoamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1nc(NS(=O)(=O)O)sc1-c1cccnc1 |
| InChI | InChI=1S/C9H7N3O5S2/c13-8(14)6-7(5-2-1-3-10-4-5)18-9(11-6)12-19(15,16)17/h1-4H,(H,11,12)(H,13,14)(H,15,16,17) |
| InChIKey | LLOVLMYLZOTEMI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|