C12H9FN2O3S — CID 89410381
2-acetamido-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 89410381) has the molecular formula C12H9FN2O3S and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-acetamido-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-acetamido-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 89410381 |
| Molecular Formula | C12H9FN2O3S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-acetamido-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)Nc1nc(C(=O)O)c(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C12H9FN2O3S/c1-6(16)14-12-15-9(11(17)18)10(19-12)7-2-4-8(13)5-3-7/h2-5H,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | MOYNAPLDOYDRMD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |