C29H21FN2OS — CID 126062830
N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 126062830) has the molecular formula C29H21FN2OS and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126062830 |
| Molecular Formula | C29H21FN2OS |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)c(-c2ccccc2)s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H21FN2OS/c30-24-18-16-22(17-19-24)26-27(23-14-8-3-9-15-23)34-29(31-26)32-28(33)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19,25H,(H,31,32,33) |
| InChIKey | RHGNYDIJLVKKBR-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |