C23H18N2OS2 — CID 43980747
N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-methylsulfanylbenzamide (PubChem CID 43980747) has the molecular formula C23H18N2OS2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-methylsulfanylbenzamide.
| Compound Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 43980747 |
| Molecular Formula | C23H18N2OS2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-(4,5-diphenyl-1,3-thiazol-2-yl)-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)Nc1nc(-c2ccccc2)c(-c2ccccc2)s1 |
| InChI | InChI=1S/C23H18N2OS2/c1-27-19-15-9-8-14-18(19)22(26)25-23-24-20(16-10-4-2-5-11-16)21(28-23)17-12-6-3-7-13-17/h2-15H,1H3,(H,24,25,26) |
| InChIKey | VNRFQEGLNRQZHZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |