C18H13N2O3S- — CID 3649410
2-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamoyl]benzoate (PubChem CID 3649410) has the molecular formula C18H13N2O3S- and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamoyl]benzoate.
| Compound Name | 2-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 3649410 |
| Molecular Formula | C18H13N2O3S- |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)carbamoyl]benzoate |
| SMILES | Cc1sc(NC(=O)c2ccccc2C(=O)[O-])nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N2O3S/c1-11-15(12-7-3-2-4-8-12)19-18(24-11)20-16(21)13-9-5-6-10-14(13)17(22)23/h2-10H,1H3,(H,22,23)(H,19,20,21)/p-1 |
| InChIKey | NGRQRRKOFUJWHP-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |