C23H15N3O5S — CID 19133212
2-[(4,5-diphenyl-1,3-thiazol-2-yl)carbamoyl]-6-nitrobenzoic acid (PubChem CID 19133212) has the molecular formula C23H15N3O5S and a molecular weight of 445.46 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,3-thiazol-2-yl)carbamoyl]-6-nitrobenzoic acid.
| Compound Name | 2-[(4,5-diphenyl-1,3-thiazol-2-yl)carbamoyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 19133212 |
| Molecular Formula | C23H15N3O5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 2-[(4,5-diphenyl-1,3-thiazol-2-yl)carbamoyl]-6-nitrobenzoic acid |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(-c2ccccc2)s1)c1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C23H15N3O5S/c27-21(16-12-7-13-17(26(30)31)18(16)22(28)29)25-23-24-19(14-8-3-1-4-9-14)20(32-23)15-10-5-2-6-11-15/h1-13H,(H,28,29)(H,24,25,27) |
| InChIKey | YLYLPBLKJRXJGK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|