C22H14BrFN2OS — CID 126060473
3-bromo-N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide (PubChem CID 126060473) has the molecular formula C22H14BrFN2OS and a molecular weight of 453.34 g/mol. Its IUPAC name is 3-bromo-N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-bromo-N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 126060473 |
| Molecular Formula | C22H14BrFN2OS |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | 3-bromo-N-[4-(4-fluorophenyl)-5-phenyl-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2)c(-c2ccccc2)s1)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H14BrFN2OS/c23-17-8-4-7-16(13-17)21(27)26-22-25-19(14-9-11-18(24)12-10-14)20(28-22)15-5-2-1-3-6-15/h1-13H,(H,25,26,27) |
| InChIKey | MCZUSKWRLFVAJE-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |