C25H18N2O3S — CID 23875650
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 23875650) has the molecular formula C25H18N2O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 23875650 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nc(-c2ccco2)c(-c2ccco2)s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O3S/c28-24(21(17-9-3-1-4-10-17)18-11-5-2-6-12-18)27-25-26-22(19-13-7-15-29-19)23(31-25)20-14-8-16-30-20/h1-16,21H,(H,26,27,28) |
| InChIKey | NSMPBMFENWQOFK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |