C22H14N2O3S — CID 7916686
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide (PubChem CID 7916686) has the molecular formula C22H14N2O3S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 7916686 |
| Molecular Formula | C22H14N2O3S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H14N2O3S/c25-21(16-10-9-14-5-1-2-6-15(14)13-16)24-22-23-19(17-7-3-11-26-17)20(28-22)18-8-4-12-27-18/h1-13H,(H,23,24,25) |
| InChIKey | JDCKHIVBGNQNFU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |