C14H9IN2O2S — CID 23144669
N-[4-(furan-2-yl)-5-iodo-1,3-thiazol-2-yl]benzamide (PubChem CID 23144669) has the molecular formula C14H9IN2O2S and a molecular weight of 396.21 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-5-iodo-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-(furan-2-yl)-5-iodo-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 23144669 |
| Molecular Formula | C14H9IN2O2S |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | N-[4-(furan-2-yl)-5-iodo-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccco2)c(I)s1)c1ccccc1 |
| InChI | InChI=1S/C14H9IN2O2S/c15-12-11(10-7-4-8-19-10)16-14(20-12)17-13(18)9-5-2-1-3-6-9/h1-8H,(H,16,17,18) |
| InChIKey | ZXRNBSUEQMQOEW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|