C20H15N3O3S — CID 23144498
N-[4-(furan-2-yl)-5-pyridin-4-yl-1,3-thiazol-2-yl]-4-methoxybenzamide (PubChem CID 23144498) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-5-pyridin-4-yl-1,3-thiazol-2-yl]-4-methoxybenzamide.
| Compound Name | N-[4-(furan-2-yl)-5-pyridin-4-yl-1,3-thiazol-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23144498 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[4-(furan-2-yl)-5-pyridin-4-yl-1,3-thiazol-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(-c3ccco3)c(-c3ccncc3)s2)cc1 |
| InChI | InChI=1S/C20H15N3O3S/c1-25-15-6-4-14(5-7-15)19(24)23-20-22-17(16-3-2-12-26-16)18(27-20)13-8-10-21-11-9-13/h2-12H,1H3,(H,22,23,24) |
| InChIKey | CFDWBLHWDJHJJG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |