C19H14N4O3S — CID 23144114
N-[4-(furan-2-yl)-5-(1-methyl-2-oxo-4-pyridinyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide (PubChem CID 23144114) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[4-(furan-2-yl)-5-(1-methyl-2-oxo-4-pyridinyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[4-(furan-2-yl)-5-(1-methyl-2-oxo-4-pyridinyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 23144114 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[4-(furan-2-yl)-5-(1-methyl-2-oxo-4-pyridinyl)-1,3-thiazol-2-yl]pyridine-4-carboxamide |
| SMILES | Cn1ccc(-c2sc(NC(=O)c3ccncc3)nc2-c2ccco2)cc1=O |
| InChI | InChI=1S/C19H14N4O3S/c1-23-9-6-13(11-15(23)24)17-16(14-3-2-10-26-14)21-19(27-17)22-18(25)12-4-7-20-8-5-12/h2-11H,1H3,(H,21,22,25) |
| InChIKey | PLIRVJHFPGLQEO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|