C23H22N2O5S — CID 16548905
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-3-ethoxy-4-propoxybenzamide (PubChem CID 16548905) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-3-ethoxy-4-propoxybenzamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-3-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 16548905 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]-3-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)Nc2nc(-c3ccco3)c(-c3ccco3)s2)cc1OCC |
| InChI | InChI=1S/C23H22N2O5S/c1-3-11-28-16-10-9-15(14-19(16)27-4-2)22(26)25-23-24-20(17-7-5-12-29-17)21(31-23)18-8-6-13-30-18/h5-10,12-14H,3-4,11H2,1-2H3,(H,24,25,26) |
| InChIKey | FOCBQKVZWNZYPG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |