C15H9FN2O4S — CID 87218532
[5-(2-fluorobenzoyl)-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 87218532) has the molecular formula C15H9FN2O4S and a molecular weight of 332.31 g/mol. Its IUPAC name is [5-(2-fluorobenzoyl)-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [5-(2-fluorobenzoyl)-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87218532 |
| Molecular Formula | C15H9FN2O4S |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [5-(2-fluorobenzoyl)-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc(-c2ccco2)c(C(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C15H9FN2O4S/c16-9-5-2-1-4-8(9)12(19)13-11(10-6-3-7-22-10)17-14(23-13)18-15(20)21/h1-7H,(H,17,18)(H,20,21) |
| InChIKey | DYOXQQUYHVULLP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |