C15H16BF4NO3 — CID 10807447
2-hydroxy-4-(2,4,6-trimethylpyridin-1-ium-1-yl)benzoic acid tetrafluoroborate (PubChem CID 10807447) has the molecular formula C15H16BF4NO3 and a molecular weight of 345.10 g/mol. Its IUPAC name is 2-hydroxy-4-(2,4,6-trimethylpyridin-1-ium-1-yl)benzoic acid tetrafluoroborate.
| Compound Name | 2-hydroxy-4-(2,4,6-trimethylpyridin-1-ium-1-yl)benzoic acid tetrafluoroborate |
|---|---|
| PubChem CID | 10807447 |
| Molecular Formula | C15H16BF4NO3 |
| Molecular Weight | 345.10 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-hydroxy-4-(2,4,6-trimethylpyridin-1-ium-1-yl)benzoic acid tetrafluoroborate |
| SMILES | Cc1cc(C)[n+](-c2ccc(C(=O)O)c(O)c2)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C15H15NO3.BF4/c1-9-6-10(2)16(11(3)7-9)12-4-5-13(15(18)19)14(17)8-12;2-1(3,4)5/h4-8H,1-3H3,(H-,17,18,19);/q;-1/p+1 |
| InChIKey | LZWWFCFEORMVDV-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 61.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|