About 4-amino-2-hydroxybenzoic acid;dihydrochloride
4-amino-2-hydroxybenzoic acid;dihydrochloride (PubChem CID 140557780) has the molecular formula C7H9Cl2NO3
and a molecular weight of 226.06 g/mol. Its IUPAC name is 4-amino-2-hydroxybenzoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-amino-2-hydroxybenzoic acid;dihydrochloride |
| PubChem CID | 140557780 |
| Molecular Formula | C7H9Cl2NO3 |
| Molecular Weight | 226.06 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | 4-amino-2-hydroxybenzoic acid;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C7H7NO3.2ClH/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3,9H,8H2,(H,10,11);2*1H |
| InChIKey | BVONOZGOLGMSFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.06 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-hydroxybenzoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-hydroxybenzoic acid;dihydrochloride?
The IUPAC name of 4-amino-2-hydroxybenzoic acid;dihydrochloride (CID 140557780) is 4-amino-2-hydroxybenzoic acid;dihydrochloride.
What is the SMILES notation for 4-amino-2-hydroxybenzoic acid;dihydrochloride?
The canonical SMILES for 4-amino-2-hydroxybenzoic acid;dihydrochloride is Cl.Cl.Nc1ccc(C(=O)O)c(O)c1.
What is the InChIKey of 4-amino-2-hydroxybenzoic acid;dihydrochloride?
The InChIKey is BVONOZGOLGMSFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.2ClH/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3,9H,8H2,(H,10,11);2*1H.
What are the key properties of 4-amino-2-hydroxybenzoic acid;dihydrochloride?
4-amino-2-hydroxybenzoic acid;dihydrochloride has a molecular weight of 226.06 g/mol, XLogP of 1.52, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-hydroxybenzoic acid;dihydrochloride is sourced from PubChem (CID 140557780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).