C8H10N2O5 — CID 67980024
4-amino-2-hydroxybenzoic acid;carbamic acid (PubChem CID 67980024) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 4-amino-2-hydroxybenzoic acid;carbamic acid.
| Compound Name | 4-amino-2-hydroxybenzoic acid;carbamic acid |
|---|---|
| PubChem CID | 67980024 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-amino-2-hydroxybenzoic acid;carbamic acid |
| SMILES | NC(=O)O.Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C7H7NO3.CH3NO2/c8-4-1-2-5(7(10)11)6(9)3-4;2-1(3)4/h1-3,9H,8H2,(H,10,11);2H2,(H,3,4) |
| InChIKey | KSQMAUIXTNERGP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|