About 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide
4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide (PubChem CID 139203630) has the molecular formula C22H19N3O4
and a molecular weight of 389.41 g/mol. Its IUPAC name is 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide.
Molecular Properties
| Compound Name | 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide |
| PubChem CID | 139203630 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide |
| SMILES | NC(=O)N1c2ccccc2C=Cc2ccccc21.Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C15H12N2O.C7H7NO3/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17;8-4-1-2-5(7(10)11)6(9)3-4/h1-10H,(H2,16,18);1-3,9H,8H2,(H,10,11) |
| InChIKey | UKNBUAXZYYPYER-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide?
The IUPAC name of 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide (CID 139203630) is 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide.
What is the SMILES notation for 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide?
The canonical SMILES for 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide is NC(=O)N1c2ccccc2C=Cc2ccccc21.Nc1ccc(C(=O)O)c(O)c1.
What is the InChIKey of 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide?
The InChIKey is UKNBUAXZYYPYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O.C7H7NO3/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17;8-4-1-2-5(7(10)11)6(9)3-4/h1-10H,(H2,16,18);1-3,9H,8H2,(H,10,11).
What are the key properties of 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide?
4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide has a molecular weight of 389.41 g/mol, XLogP of 4.06, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-hydroxybenzoic acid;benzo[b][1]benzazepine-11-carboxamide is sourced from PubChem (CID 139203630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).