About lithium;4-amino-2-hydroxybenzoic acid;hydride
lithium;4-amino-2-hydroxybenzoic acid;hydride (PubChem CID 173041117) has the molecular formula C7H8LiNO3
and a molecular weight of 161.09 g/mol. Its IUPAC name is lithium;4-amino-2-hydroxybenzoic acid;hydride.
Molecular Properties
| Compound Name | lithium;4-amino-2-hydroxybenzoic acid;hydride |
| PubChem CID | 173041117 |
| Molecular Formula | C7H8LiNO3 |
| Molecular Weight | 161.09 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | lithium;4-amino-2-hydroxybenzoic acid;hydride |
| SMILES | Nc1ccc(C(=O)O)c(O)c1.[H-].[Li+] |
| InChI | InChI=1S/C7H7NO3.Li.H/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3,9H,8H2,(H,10,11);;/q;+1;-1 |
| InChIKey | FPDBMMDMEOBKSM-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.09 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze lithium;4-amino-2-hydroxybenzoic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;4-amino-2-hydroxybenzoic acid;hydride?
The IUPAC name of lithium;4-amino-2-hydroxybenzoic acid;hydride (CID 173041117) is lithium;4-amino-2-hydroxybenzoic acid;hydride.
What is the SMILES notation for lithium;4-amino-2-hydroxybenzoic acid;hydride?
The canonical SMILES for lithium;4-amino-2-hydroxybenzoic acid;hydride is Nc1ccc(C(=O)O)c(O)c1.[H-].[Li+].
What is the InChIKey of lithium;4-amino-2-hydroxybenzoic acid;hydride?
The InChIKey is FPDBMMDMEOBKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.Li.H/c8-4-1-2-5(7(10)11)6(9)3-4;;/h1-3,9H,8H2,(H,10,11);;/q;+1;-1.
What are the key properties of lithium;4-amino-2-hydroxybenzoic acid;hydride?
lithium;4-amino-2-hydroxybenzoic acid;hydride has a molecular weight of 161.09 g/mol, XLogP of -2.21, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;4-amino-2-hydroxybenzoic acid;hydride is sourced from PubChem (CID 173041117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).