C21H28ClNO7 — CID 10623045
4-(2,6-ditert-butyl-4-methylpyridin-1-ium-1-yl)-2-hydroxybenzoic acid perchlorate (PubChem CID 10623045) has the molecular formula C21H28ClNO7 and a molecular weight of 441.91 g/mol. Its IUPAC name is 4-(2,6-ditert-butyl-4-methylpyridin-1-ium-1-yl)-2-hydroxybenzoic acid perchlorate.
| Compound Name | 4-(2,6-ditert-butyl-4-methylpyridin-1-ium-1-yl)-2-hydroxybenzoic acid perchlorate |
|---|---|
| PubChem CID | 10623045 |
| Molecular Formula | C21H28ClNO7 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-(2,6-ditert-butyl-4-methylpyridin-1-ium-1-yl)-2-hydroxybenzoic acid perchlorate |
| SMILES | Cc1cc(C(C)(C)C)[n+](-c2ccc(C(=O)O)c(O)c2)c(C(C)(C)C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H27NO3.ClHO4/c1-13-10-17(20(2,3)4)22(18(11-13)21(5,6)7)14-8-9-15(19(24)25)16(23)12-14;2-1(3,4)5/h8-12H,1-7H3,(H-,23,24,25);(H,2,3,4,5) |
| InChIKey | IWHMWTXUXUASMR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|