C15H12O8 — CID 174971569
4-hydroxybenzoic acid;2-hydroxyterephthalic acid (PubChem CID 174971569) has the molecular formula C15H12O8 and a molecular weight of 320.25 g/mol. Its IUPAC name is 4-hydroxybenzoic acid;2-hydroxyterephthalic acid.
| Compound Name | 4-hydroxybenzoic acid;2-hydroxyterephthalic acid |
|---|---|
| PubChem CID | 174971569 |
| Molecular Formula | C15H12O8 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-hydroxybenzoic acid;2-hydroxyterephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(O)c1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H6O5.C7H6O3/c9-6-3-4(7(10)11)1-2-5(6)8(12)13;8-6-3-1-5(2-4-6)7(9)10/h1-3,9H,(H,10,11)(H,12,13);1-4,8H,(H,9,10) |
| InChIKey | RAGGJEKHJKQJIX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |