C24H22O5 — CID 171715325
4-[2-[4-[2-(4-carboxyphenyl)ethyl]phenyl]ethyl]-2-hydroxybenzoic acid (PubChem CID 171715325) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-[2-[4-[2-(4-carboxyphenyl)ethyl]phenyl]ethyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-[4-[2-(4-carboxyphenyl)ethyl]phenyl]ethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171715325 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-[2-[4-[2-(4-carboxyphenyl)ethyl]phenyl]ethyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(CCc2ccc(CCc3ccc(C(=O)O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C24H22O5/c25-22-15-19(11-14-21(22)24(28)29)8-7-17-3-1-16(2-4-17)5-6-18-9-12-20(13-10-18)23(26)27/h1-4,9-15,25H,5-8H2,(H,26,27)(H,28,29) |
| InChIKey | XAXQDWQQYNJSGZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |