C24H22O7 — CID 171715379
4-[2-[3-[2-(4-carboxy-3-hydroxyphenyl)ethyl]-5-hydroxyphenyl]ethyl]-2-hydroxybenzoic acid (PubChem CID 171715379) has the molecular formula C24H22O7 and a molecular weight of 422.43 g/mol. Its IUPAC name is 4-[2-[3-[2-(4-carboxy-3-hydroxyphenyl)ethyl]-5-hydroxyphenyl]ethyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-[3-[2-(4-carboxy-3-hydroxyphenyl)ethyl]-5-hydroxyphenyl]ethyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 171715379 |
| Molecular Formula | C24H22O7 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-[2-[3-[2-(4-carboxy-3-hydroxyphenyl)ethyl]-5-hydroxyphenyl]ethyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(CCc2cc(O)cc(CCc3ccc(C(=O)O)c(O)c3)c2)cc1O |
| InChI | InChI=1S/C24H22O7/c25-18-10-16(3-1-14-5-7-19(23(28)29)21(26)12-14)9-17(11-18)4-2-15-6-8-20(24(30)31)22(27)13-15/h5-13,25-27H,1-4H2,(H,28,29)(H,30,31) |
| InChIKey | DEUXAXDPKPAREP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |