C14H11ClO4 — CID 175278741
4-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzoic acid (PubChem CID 175278741) has the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. Its IUPAC name is 4-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 175278741 |
| Molecular Formula | C14H11ClO4 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(Cc2cc(Cl)ccc2O)cc1O |
| InChI | InChI=1S/C14H11ClO4/c15-10-2-4-12(16)9(7-10)5-8-1-3-11(14(18)19)13(17)6-8/h1-4,6-7,16-17H,5H2,(H,18,19) |
| InChIKey | WXFURHHPULWGFV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |