C16H13ClO5 — CID 163677042
4-chloro-2-[3-(3,4-dihydroxyphenyl)-2-oxopropyl]benzoic acid (PubChem CID 163677042) has the molecular formula C16H13ClO5 and a molecular weight of 320.73 g/mol. Its IUPAC name is 4-chloro-2-[3-(3,4-dihydroxyphenyl)-2-oxopropyl]benzoic acid.
| Compound Name | 4-chloro-2-[3-(3,4-dihydroxyphenyl)-2-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 163677042 |
| Molecular Formula | C16H13ClO5 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 4-chloro-2-[3-(3,4-dihydroxyphenyl)-2-oxopropyl]benzoic acid |
| SMILES | O=C(Cc1ccc(O)c(O)c1)Cc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C16H13ClO5/c17-11-2-3-13(16(21)22)10(7-11)8-12(18)5-9-1-4-14(19)15(20)6-9/h1-4,6-7,19-20H,5,8H2,(H,21,22) |
| InChIKey | JHOHAZRWEZJHGM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|