C23H22O7 — CID 171715552
4-[2-[4,5-dihydroxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]ethyl]benzoic acid (PubChem CID 171715552) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is 4-[2-[4,5-dihydroxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[4,5-dihydroxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 171715552 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-[2-[4,5-dihydroxy-2-[2-(3,4,5-trihydroxyphenyl)ethyl]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2cc(O)c(O)cc2CCc2cc(O)c(O)c(O)c2)cc1 |
| InChI | InChI=1S/C23H22O7/c24-18-11-16(7-3-13-1-5-15(6-2-13)23(29)30)17(12-19(18)25)8-4-14-9-20(26)22(28)21(27)10-14/h1-2,5-6,9-12,24-28H,3-4,7-8H2,(H,29,30) |
| InChIKey | FAHGYXBYNGAOTH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|