About 4-(2-Aminoethyl)-benzoic acid sodium
4-(2-Aminoethyl)-benzoic acid sodium (PubChem CID 70590830) has the molecular formula C9H11NNaO2
and a molecular weight of 188.18 g/mol.
Molecular Properties
| Compound Name | 4-(2-Aminoethyl)-benzoic acid sodium |
| PubChem CID | 70590830 |
| Molecular Formula | C9H11NNaO2 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | — |
| SMILES | NCCc1ccc(C(=O)O)cc1.[Na] |
| InChI | InChI=1S/C9H11NO2.Na/c10-6-5-7-1-3-8(4-2-7)9(11)12;/h1-4H,5-6,10H2,(H,11,12); |
| InChIKey | WCLAVUGBGKPHOR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-Aminoethyl)-benzoic acid sodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-Aminoethyl)-benzoic acid sodium?
The IUPAC name of 4-(2-Aminoethyl)-benzoic acid sodium (CID 70590830) is not available.
What is the SMILES notation for 4-(2-Aminoethyl)-benzoic acid sodium?
The canonical SMILES for 4-(2-Aminoethyl)-benzoic acid sodium is NCCc1ccc(C(=O)O)cc1.[Na].
What is the InChIKey of 4-(2-Aminoethyl)-benzoic acid sodium?
The InChIKey is WCLAVUGBGKPHOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.Na/c10-6-5-7-1-3-8(4-2-7)9(11)12;/h1-4H,5-6,10H2,(H,11,12);.
What are the key properties of 4-(2-Aminoethyl)-benzoic acid sodium?
4-(2-Aminoethyl)-benzoic acid sodium has a molecular weight of 188.18 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-Aminoethyl)-benzoic acid sodium is sourced from PubChem (CID 70590830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).