C22H21NO5 — CID 175639823
4-[2-[5-[2-(3,4,5-trihydroxyphenyl)ethyl]-3-pyridinyl]ethyl]benzoic acid (PubChem CID 175639823) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-[2-[5-[2-(3,4,5-trihydroxyphenyl)ethyl]-3-pyridinyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[5-[2-(3,4,5-trihydroxyphenyl)ethyl]-3-pyridinyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175639823 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[2-[5-[2-(3,4,5-trihydroxyphenyl)ethyl]-3-pyridinyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2cncc(CCc3cc(O)c(O)c(O)c3)c2)cc1 |
| InChI | InChI=1S/C22H21NO5/c24-19-10-15(11-20(25)21(19)26)2-4-17-9-16(12-23-13-17)3-1-14-5-7-18(8-6-14)22(27)28/h5-13,24-26H,1-4H2,(H,27,28) |
| InChIKey | UXEYBVGOMSTVMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|