C21H20N2O4 — CID 175639773
4-[2-[6-[2-(3,5-dihydroxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoic acid (PubChem CID 175639773) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-[2-[6-[2-(3,5-dihydroxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[6-[2-(3,5-dihydroxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175639773 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-[2-[6-[2-(3,5-dihydroxyphenyl)ethyl]pyrazin-2-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2cncc(CCc3cc(O)cc(O)c3)n2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c24-19-9-15(10-20(25)11-19)4-8-18-13-22-12-17(23-18)7-3-14-1-5-16(6-2-14)21(26)27/h1-2,5-6,9-13,24-25H,3-4,7-8H2,(H,26,27) |
| InChIKey | CVDICPZEYJYXDB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |