C20H26N5+ — CID 11782623
2,6-dibutyl-4-phenyl-1-(2H-tetrazol-5-yl)pyridin-1-ium (PubChem CID 11782623) has the molecular formula C20H26N5+ and a molecular weight of 336.46 g/mol. Its IUPAC name is 2,6-dibutyl-4-phenyl-1-(2H-tetrazol-5-yl)pyridin-1-ium.
| Compound Name | 2,6-dibutyl-4-phenyl-1-(2H-tetrazol-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 11782623 |
| Molecular Formula | C20H26N5+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 2,6-dibutyl-4-phenyl-1-(2H-tetrazol-5-yl)pyridin-1-ium |
| SMILES | CCCCc1cc(-c2ccccc2)cc(CCCC)[n+]1-c1nn[nH]n1 |
| InChI | InChI=1S/C20H26N5/c1-3-5-12-18-14-17(16-10-8-7-9-11-16)15-19(13-6-4-2)25(18)20-21-23-24-22-20/h7-11,14-15H,3-6,12-13H2,1-2H3,(H,21,22,23,24)/q+1 |
| InChIKey | IZJBTFZQZBQKSH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|