C21H22FN2+ — CID 151605944
6-butyl-3-fluoro-2,4-diphenylpyridin-1-ium-1-amine (PubChem CID 151605944) has the molecular formula C21H22FN2+ and a molecular weight of 321.42 g/mol. Its IUPAC name is 6-butyl-3-fluoro-2,4-diphenylpyridin-1-ium-1-amine.
| Compound Name | 6-butyl-3-fluoro-2,4-diphenylpyridin-1-ium-1-amine |
|---|---|
| PubChem CID | 151605944 |
| Molecular Formula | C21H22FN2+ |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 6-butyl-3-fluoro-2,4-diphenylpyridin-1-ium-1-amine |
| SMILES | CCCCc1cc(-c2ccccc2)c(F)c(-c2ccccc2)[n+]1N |
| InChI | InChI=1S/C21H22FN2/c1-2-3-14-18-15-19(16-10-6-4-7-11-16)20(22)21(24(18)23)17-12-8-5-9-13-17/h4-13,15H,2-3,14,23H2,1H3/q+1 |
| InChIKey | QLLUTGQESGMIOH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|