C17H18BrF — CID 23127891
2-bromo-3-fluoro-1-pentyl-4-phenylbenzene (PubChem CID 23127891) has the molecular formula C17H18BrF and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-bromo-3-fluoro-1-pentyl-4-phenylbenzene.
| Compound Name | 2-bromo-3-fluoro-1-pentyl-4-phenylbenzene |
|---|---|
| PubChem CID | 23127891 |
| Molecular Formula | C17H18BrF |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-bromo-3-fluoro-1-pentyl-4-phenylbenzene |
| SMILES | CCCCCc1ccc(-c2ccccc2)c(F)c1Br |
| InChI | InChI=1S/C17H18BrF/c1-2-3-5-10-14-11-12-15(17(19)16(14)18)13-8-6-4-7-9-13/h4,6-9,11-12H,2-3,5,10H2,1H3 |
| InChIKey | WIPPDJWAZDFYJO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|