C18H18O3 — CID 140702855
4-pentyl-7-phenyl-1,3-benzodioxol-2-one (PubChem CID 140702855) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-pentyl-7-phenyl-1,3-benzodioxol-2-one.
| Compound Name | 4-pentyl-7-phenyl-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 140702855 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-pentyl-7-phenyl-1,3-benzodioxol-2-one |
| SMILES | CCCCCc1ccc(-c2ccccc2)c2oc(=O)oc12 |
| InChI | InChI=1S/C18H18O3/c1-2-3-5-10-14-11-12-15(13-8-6-4-7-9-13)17-16(14)20-18(19)21-17/h4,6-9,11-12H,2-3,5,10H2,1H3 |
| InChIKey | AMYOAMZNIDYXFW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|