C21H20N5+ — CID 10914805
2,4-diphenyl-6-propyl-1-(2H-tetrazol-5-yl)pyridin-1-ium (PubChem CID 10914805) has the molecular formula C21H20N5+ and a molecular weight of 342.43 g/mol. Its IUPAC name is 2,4-diphenyl-6-propyl-1-(2H-tetrazol-5-yl)pyridin-1-ium.
| Compound Name | 2,4-diphenyl-6-propyl-1-(2H-tetrazol-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 10914805 |
| Molecular Formula | C21H20N5+ |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2,4-diphenyl-6-propyl-1-(2H-tetrazol-5-yl)pyridin-1-ium |
| SMILES | CCCc1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1nn[nH]n1 |
| InChI | InChI=1S/C21H20N5/c1-2-9-19-14-18(16-10-5-3-6-11-16)15-20(17-12-7-4-8-13-17)26(19)21-22-24-25-23-21/h3-8,10-15H,2,9H2,1H3,(H,22,23,24,25)/q+1 |
| InChIKey | BKSQTUYHJDJCIQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|