C27H23N4S+ — CID 10673895
2-[5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,3,4-thiadiazol-2-yl]ethanamine (PubChem CID 10673895) has the molecular formula C27H23N4S+ and a molecular weight of 435.58 g/mol. Its IUPAC name is 2-[5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,3,4-thiadiazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,3,4-thiadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 10673895 |
| Molecular Formula | C27H23N4S+ |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[5-(2,4,6-triphenylpyridin-1-ium-1-yl)-1,3,4-thiadiazol-2-yl]ethanamine |
| SMILES | NCCc1nnc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)s1 |
| InChI | InChI=1S/C27H23N4S/c28-17-16-26-29-30-27(32-26)31-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(31)22-14-8-3-9-15-22/h1-15,18-19H,16-17,28H2/q+1 |
| InChIKey | RODZNOMXUOWKJH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|