C28H25ClN4O4S — CID 10506838
5-[3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl]-1,3,4-thiadiazol-2-amine perchlorate (PubChem CID 10506838) has the molecular formula C28H25ClN4O4S and a molecular weight of 549.05 g/mol. Its IUPAC name is 5-[3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl]-1,3,4-thiadiazol-2-amine perchlorate.
| Compound Name | 5-[3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl]-1,3,4-thiadiazol-2-amine perchlorate |
|---|---|
| PubChem CID | 10506838 |
| Molecular Formula | C28H25ClN4O4S |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 5-[3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl]-1,3,4-thiadiazol-2-amine perchlorate |
| SMILES | Nc1nnc(CCC[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C28H25N4S.ClHO4/c29-28-31-30-27(33-28)17-10-18-32-25(22-13-6-2-7-14-22)19-24(21-11-4-1-5-12-21)20-26(32)23-15-8-3-9-16-23;2-1(3,4)5/h1-9,11-16,19-20H,10,17-18H2,(H2,29,31);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BZQBLUSIZICEAD-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|