C31H34BF4N — CID 12564811
1-octyl-2,4,6-triphenylpyridin-1-ium tetrafluoroborate (PubChem CID 12564811) has the molecular formula C31H34BF4N and a molecular weight of 507.42 g/mol. Its IUPAC name is 1-octyl-2,4,6-triphenylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1-octyl-2,4,6-triphenylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 12564811 |
| Molecular Formula | C31H34BF4N |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 1-octyl-2,4,6-triphenylpyridin-1-ium tetrafluoroborate |
| SMILES | CCCCCCCC[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H34N.BF4/c1-2-3-4-5-6-16-23-32-30(27-19-12-8-13-20-27)24-29(26-17-10-7-11-18-26)25-31(32)28-21-14-9-15-22-28;2-1(3,4)5/h7-15,17-22,24-25H,2-6,16,23H2,1H3;/q+1;-1 |
| InChIKey | OQHVNSZVTIPUDN-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|