C42H38N3+ — CID 98328853
1-butyl-4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-2,6-diphenylpyridin-1-ium (PubChem CID 98328853) has the molecular formula C42H38N3+ and a molecular weight of 584.79 g/mol. Its IUPAC name is 1-butyl-4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-2,6-diphenylpyridin-1-ium.
| Compound Name | 1-butyl-4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-2,6-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 98328853 |
| Molecular Formula | C42H38N3+ |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 1-butyl-4-[4-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]-2,6-diphenylpyridin-1-ium |
| SMILES | CCCC[n+]1c(-c2ccccc2)cc(-c2ccc(N3N=C(c4ccccc4)C[C@H]3c3ccccc3)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C42H38N3/c1-2-3-28-44-40(34-18-10-5-11-19-34)29-37(30-41(44)35-20-12-6-13-21-35)32-24-26-38(27-25-32)45-42(36-22-14-7-15-23-36)31-39(43-45)33-16-8-4-9-17-33/h4-27,29-30,42H,2-3,28,31H2,1H3/q+1/t42-/m0/s1 |
| InChIKey | YWOKLFHAWNPHQD-WBCKFURZSA-N |
| XLogP | 10.13 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|