C39H31BrN3+ — CID 98328852
4-[4-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-1-methyl-2,6-diphenylpyridin-1-ium (PubChem CID 98328852) has the molecular formula C39H31BrN3+ and a molecular weight of 621.60 g/mol. Its IUPAC name is 4-[4-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-1-methyl-2,6-diphenylpyridin-1-ium.
| Compound Name | 4-[4-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-1-methyl-2,6-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 98328852 |
| Molecular Formula | C39H31BrN3+ |
| Molecular Weight | 621.60 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 4-[4-[(3R)-5-(4-bromophenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]phenyl]-1-methyl-2,6-diphenylpyridin-1-ium |
| SMILES | C[n+]1c(-c2ccccc2)cc(-c2ccc(N3N=C(c4ccc(Br)cc4)C[C@@H]3c3ccccc3)cc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C39H31BrN3/c1-42-37(30-11-5-2-6-12-30)25-33(26-38(42)31-13-7-3-8-14-31)28-19-23-35(24-20-28)43-39(32-15-9-4-10-16-32)27-36(41-43)29-17-21-34(40)22-18-29/h2-26,39H,27H2,1H3/q+1/t39-/m1/s1 |
| InChIKey | OKXMUDDQHRYMDB-LDLOPFEMSA-N |
| XLogP | 9.63 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.60 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|