C21H18BrN3 — CID 3434506
3-[3-(4-bromophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]aniline (PubChem CID 3434506) has the molecular formula C21H18BrN3 and a molecular weight of 392.30 g/mol. Its IUPAC name is 3-[3-(4-bromophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]aniline.
| Compound Name | 3-[3-(4-bromophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]aniline |
|---|---|
| PubChem CID | 3434506 |
| Molecular Formula | C21H18BrN3 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 3-[3-(4-bromophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]aniline |
| SMILES | Nc1cccc(C2=NN(c3ccccc3)C(c3ccc(Br)cc3)C2)c1 |
| InChI | InChI=1S/C21H18BrN3/c22-17-11-9-15(10-12-17)21-14-20(16-5-4-6-18(23)13-16)24-25(21)19-7-2-1-3-8-19/h1-13,21H,14,23H2 |
| InChIKey | VEZOMDXKIVDERH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|