C30H30O — CID 140656741
4-phenyl-2,6-bis(2,4,6-trimethylphenyl)phenol (PubChem CID 140656741) has the molecular formula C30H30O and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-phenyl-2,6-bis(2,4,6-trimethylphenyl)phenol.
| Compound Name | 4-phenyl-2,6-bis(2,4,6-trimethylphenyl)phenol |
|---|---|
| PubChem CID | 140656741 |
| Molecular Formula | C30H30O |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-phenyl-2,6-bis(2,4,6-trimethylphenyl)phenol |
| SMILES | Cc1cc(C)c(-c2cc(-c3ccccc3)cc(-c3c(C)cc(C)cc3C)c2O)c(C)c1 |
| InChI | InChI=1S/C30H30O/c1-18-12-20(3)28(21(4)13-18)26-16-25(24-10-8-7-9-11-24)17-27(30(26)31)29-22(5)14-19(2)15-23(29)6/h7-17,31H,1-6H3 |
| InChIKey | SQFVYBBWZQIDEW-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |