About 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium
2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium (PubChem CID 168892681) has the molecular formula C22H24N+
and a molecular weight of 302.44 g/mol. Its IUPAC name is 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium |
| PubChem CID | 168892681 |
| Molecular Formula | C22H24N+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium |
| SMILES | Cc1cc(C)c(-[n+]2c(C)cc(-c3ccccc3)cc2C)c(C)c1 |
| InChI | InChI=1S/C22H24N/c1-15-11-16(2)22(17(3)12-15)23-18(4)13-21(14-19(23)5)20-9-7-6-8-10-20/h6-14H,1-5H3/q+1 |
| InChIKey | IUQROGGVNNSVSK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium?
The IUPAC name of 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium (CID 168892681) is 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium.
What is the SMILES notation for 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium?
The canonical SMILES for 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium is Cc1cc(C)c(-[n+]2c(C)cc(-c3ccccc3)cc2C)c(C)c1.
What is the InChIKey of 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium?
The InChIKey is IUQROGGVNNSVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N/c1-15-11-16(2)22(17(3)12-15)23-18(4)13-21(14-19(23)5)20-9-7-6-8-10-20/h6-14H,1-5H3/q+1.
What are the key properties of 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium?
2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium has a molecular weight of 302.44 g/mol, XLogP of 5.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-phenyl-1-(2,4,6-trimethylphenyl)pyridin-1-ium is sourced from PubChem (CID 168892681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).