C22H24NO+ — CID 168892691
1-(2,6-dimethylphenyl)-4-(4-methoxyphenyl)-2,6-dimethylpyridin-1-ium (PubChem CID 168892691) has the molecular formula C22H24NO+ and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-4-(4-methoxyphenyl)-2,6-dimethylpyridin-1-ium.
| Compound Name | 1-(2,6-dimethylphenyl)-4-(4-methoxyphenyl)-2,6-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 168892691 |
| Molecular Formula | C22H24NO+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-4-(4-methoxyphenyl)-2,6-dimethylpyridin-1-ium |
| SMILES | COc1ccc(-c2cc(C)[n+](-c3c(C)cccc3C)c(C)c2)cc1 |
| InChI | InChI=1S/C22H24NO/c1-15-7-6-8-16(2)22(15)23-17(3)13-20(14-18(23)4)19-9-11-21(24-5)12-10-19/h6-14H,1-5H3/q+1 |
| InChIKey | PCSPDSLBBOMQDJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|