C20H16F2O — CID 121356402
1,3-difluoro-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene (PubChem CID 121356402) has the molecular formula C20H16F2O and a molecular weight of 310.34 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene.
| Compound Name | 1,3-difluoro-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 121356402 |
| Molecular Formula | C20H16F2O |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1,3-difluoro-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene |
| SMILES | COc1ccc(-c2cc(F)c(-c3ccc(C)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C20H16F2O/c1-13-3-5-15(6-4-13)20-18(21)11-16(12-19(20)22)14-7-9-17(23-2)10-8-14/h3-12H,1-2H3 |
| InChIKey | MODVOIUCIGXZQQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |