C32H24Br2O — CID 101257502
1,3-bis(2-bromophenyl)-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene (PubChem CID 101257502) has the molecular formula C32H24Br2O and a molecular weight of 584.35 g/mol. Its IUPAC name is 1,3-bis(2-bromophenyl)-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene.
| Compound Name | 1,3-bis(2-bromophenyl)-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 101257502 |
| Molecular Formula | C32H24Br2O |
| Molecular Weight | 584.35 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 1,3-bis(2-bromophenyl)-5-(4-methoxyphenyl)-2-(4-methylphenyl)benzene |
| SMILES | COc1ccc(-c2cc(-c3ccccc3Br)c(-c3ccc(C)cc3)c(-c3ccccc3Br)c2)cc1 |
| InChI | InChI=1S/C32H24Br2O/c1-21-11-13-23(14-12-21)32-28(26-7-3-5-9-30(26)33)19-24(22-15-17-25(35-2)18-16-22)20-29(32)27-8-4-6-10-31(27)34/h3-20H,1-2H3 |
| InChIKey | JHHAMFVSOPSDHJ-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.35 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |