C27H10F10O — CID 87458156
9-(3,4-difluorophenyl)-1,2,3,4,5,6,7,8-octafluoro-10-(4-methoxyphenyl)anthracene (PubChem CID 87458156) has the molecular formula C27H10F10O and a molecular weight of 540.36 g/mol. Its IUPAC name is 9-(3,4-difluorophenyl)-1,2,3,4,5,6,7,8-octafluoro-10-(4-methoxyphenyl)anthracene.
| Compound Name | 9-(3,4-difluorophenyl)-1,2,3,4,5,6,7,8-octafluoro-10-(4-methoxyphenyl)anthracene |
|---|---|
| PubChem CID | 87458156 |
| Molecular Formula | C27H10F10O |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 9-(3,4-difluorophenyl)-1,2,3,4,5,6,7,8-octafluoro-10-(4-methoxyphenyl)anthracene |
| SMILES | COc1ccc(-c2c3c(F)c(F)c(F)c(F)c3c(-c3ccc(F)c(F)c3)c3c(F)c(F)c(F)c(F)c23)cc1 |
| InChI | InChI=1S/C27H10F10O/c1-38-11-5-2-9(3-6-11)14-16-18(22(32)26(36)24(34)20(16)30)15(10-4-7-12(28)13(29)8-10)19-17(14)21(31)25(35)27(37)23(19)33/h2-8H,1H3 |
| InChIKey | IPMJWUIDJGVDLH-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|