C19H11F5O — CID 139240862
1,2,3,4,5-pentafluoro-6-[2-(4-methoxyphenyl)phenyl]benzene (PubChem CID 139240862) has the molecular formula C19H11F5O and a molecular weight of 350.29 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-(4-methoxyphenyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-(4-methoxyphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 139240862 |
| Molecular Formula | C19H11F5O |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-(4-methoxyphenyl)phenyl]benzene |
| SMILES | COc1ccc(-c2ccccc2-c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H11F5O/c1-25-11-8-6-10(7-9-11)12-4-2-3-5-13(12)14-15(20)17(22)19(24)18(23)16(14)21/h2-9H,1H3 |
| InChIKey | YXEXZJSWIOIZRD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|